Z-THR(TBU)-OME (This compound) is a protected amino acid derivative commonly used as a building block in peptide synthesis. It features a benzyloxycarbonyl (Cbz) amino protecting group and a tert-butyl ether side-chain protection on the threonine residue, making it suitable for stepwise solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 52785-41-8
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid building block
Boc-Trp(Boc)-OH
Protected amino acid building block
Fmoc-Thr(tBu)-Thr(Psi(Me,Me)pro)-OH
Protected amino acid building block
Boc-lysine
Protected amino acid building block
Methyl (4-cyanophenyl)acetate
Pharmaceutical intermediate for API synthesis
(S)-Benzyl 2-amino-3-(4-(benzyloxy)phenyl)propanoate
protected amino acid intermediate
6-(Bromomethyl)-2-imino-2,3-dihydropteridin-4-amine--hydrogen bromide (1/1)
Pharmaceutical intermediate synthesis
Telmisartan methyl ester
pharmaceutical intermediate
methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate
NKWFWFWEJCKORD-OCCSQVGLSA-N
C[C@H]([C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)OC(C)(C)C