Acetaminophen mercapturate is an S-substituted N-acetyl-L-cysteine derivative and a metabolite of paracetamol (acetaminophen). It is primarily significant as a human urinary metabolite reference standard used in analytical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Acetaminophen mercapturate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-(3-Hydroxyphenyl)-3-hydroxypropanoic acid
human urinary metabolite reference standard
Methyl (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
chiral building block for synthesis
(3-Bromopyridin-2-yl)methanol
research compound
Cyclopropaneacetic acid
research compound
(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; Palladium
palladium-catalyzed cross-coupling reactions catalyst
(2R)-2-acetamido-3-(5-acetamido-2-hydroxyphenyl)sulfanylpropanoic acid
DVPRQNKJGQEICH-JTQLQIEISA-N
CC(=O)NC1=CC(=C(C=C1)O)SC[C@@H](C(=O)O)NC(=O)C
Acetaminophen mercapturate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.