3-(3-Hydroxyphenyl)-3-hydroxypropanoic acid is a dihydroxy monocarboxylic acid that serves as a human urinary metabolite. It is structurally characterized by a 3-hydroxyphenyl group attached to 3-hydroxypropanoic acid.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-(3-Hydroxyphenyl)-3-hydroxypropanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Acetaminophen mercapturate
human urinary metabolite reference standard
Trideuterio(deuteriooxy)(113C)methane
Isotopically labeled methanol standard
3-METHOXYFURAN-2-CARBALDEHYDE
research compound
3-amino-3-(4-fluorophenyl)propanoic acid
glycine reuptake inhibitor
Tetrabutylammonium hydrogen sulfate
phase transfer catalyst
3-hydroxy-3-(3-hydroxyphenyl)propanoic acid
KHTAGVZHYUZYMF-UHFFFAOYSA-N
C1=CC(=CC(=C1)O)C(CC(=O)O)O
3-(3-Hydroxyphenyl)-3-hydroxypropanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.