This compound is a nitrosamine impurity standard, specifically the (R,R)-stereoisomer of dinitrosoethambutol. It is primarily used as a reference substance in analytical chemistry to detect and quantify nitrosamine impurities in pharmaceutical products.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dinitrosoethambutol, (R,R)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N,N'-Dinitroso-N,N'-bis(phenylmethyl)-1,2-ethanediamine
nitrosamine impurity standard
1-Nitroso-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
nitrosamine impurity standard
Tetracaine Impurity 39
nitrosamine impurity standard
L-Erythrulose
Human metabolite
1-Acetyl-2-imidazolidinone
Impurity standard
Chlorovinyl dichloroarsine
Chemical warfare blister agent
Cyclopentyl phenyl ketone
chemical intermediate
N-[(2R)-1-hydroxybutan-2-yl]-N-[2-[[(2R)-1-hydroxybutan-2-yl]-nitrosoamino]ethyl]nitrous amide
GEIAKCPGVIYGOY-NXEZZACHSA-N
CC[C@H](CO)N(CCN([C@H](CC)CO)N=O)N=O
Dinitrosoethambutol, (R,R)- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.