Tetracaine Impurity 39 is a chemical compound identified as a nitrosamine impurity standard. It is primarily used as a reference material in pharmaceutical quality control and analytical testing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Tetracaine Impurity 39 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-nitroso-tetracaine
Nitrosamine impurity reference standard
Dinitrosoethambutol, (R,R)-
nitrosamine impurity standard
N,N'-Dinitroso-N,N'-bis(phenylmethyl)-1,2-ethanediamine
nitrosamine impurity standard
1-Nitroso-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
nitrosamine impurity standard
5,11-Dichlorotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene
Dichloro-[2.2]-paracyclophane derivative
4-Nitronicotinic acid N-oxide
research compound
1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene
organic synthesis building block
3r-(3r-hydroxybutyryloxy)butyric acid
sex pheromone and fungal metabolite
ethyl 4-[butyl(nitroso)amino]benzoate
PRWBPCZATTVMMN-UHFFFAOYSA-N
CCCCN(C1=CC=C(C=C1)C(=O)OCC)N=O
Tetracaine Impurity 39 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.