Diethyl succinate-2,2,3,3-d4 is a deuterated internal standard used primarily in analytical chemistry and mass spectrometry. It is a labeled form of diethyl succinate where four hydrogen atoms are replaced with deuterium, enabling precise quantification in research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Diethyl succinate-2,2,3,3-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Acetaminophen-d4 (major)
deuterated internal standard
1,3,5-Trimethylbenzene-d12
deuterated internal standard
2-Ethylphenol-d10
deuterated internal standard
2-METHYL-D3-PROPYL-3,3,3-D3 ALCOHOL
deuterated internal standard
1,4-Dibromobutane-2,2,3,3-d4
deuterated research reagent
LUMINOL
chemiluminescent reagent for trace detection
3-Amino-2-methylbenzoic acid
building block for organic synthesis
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
Diethyl succinate-2,2,3,3-d4(CAS 52089-62-0)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
diethyl 2,2,3,3-tetradeuteriobutanedioate
DKMROQRQHGEIOW-NZLXMSDQSA-N
[2H]C([2H])(C(=O)OCC)C([2H])([2H])C(=O)OCC
Diethyl succinate-2,2,3,3-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.