Luminol is a chemiluminescent reagent that appears as yellow crystals or light beige powder. It is primarily used to detect trace amounts of copper, iron, peroxides, and cyanides by producing light when oxidized.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
LUMINOL 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Amino-2-methylbenzoic acid
building block for organic synthesis
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
7-Methoxy-1,2-dihydronaphthalene
chemical research intermediate
3-Bromo-2-chloropyridine
research chemical
Phthalhydrazide
research compound
4-Aminophthalhydrazide
chemiluminescent label
LUMINOL(CAS 521-31-3)의 국제 HS 코드는 2933.99입니다.
2933.99
2933 99 80
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
5-amino-2,3-dihydrophthalazine-1,4-dione
HWYHZTIRURJOHG-UHFFFAOYSA-N
C1=CC2=C(C(=C1)N)C(=O)NNC2=O
LUMINOL 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.