4-Methyl-D-phenylalanine is a non-proteinogenic amino acid derivative with a methyl substituent on the aromatic ring. It serves as a specialized peptide building block in solid-phase synthesis, primarily for incorporating D-stereochemistry into peptide chains.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 49759-61-7
(2S,3R)-3-acetamido-2-hydroxy-4-phenylbutanoic acid
peptide building block for synthesis
Scopine
pharmaceutical intermediate
Isonipecotic acid
pharmaceutical intermediate
2-Azabicyclo[2.2.1]hept-5-en-3-one
Pharmaceutical intermediate for abacavir synthesis
Mercaptopurine disulfide
Pharmaceutical intermediate for thiopurine derivatives
4-Methyl-L-phenylalanine
Research compound for peptide synthesis
(2R)-2-amino-3-(4-methylphenyl)propanoic acid
DQLHSFUMICQIMB-SECBINFHSA-N
CC1=CC=C(C=C1)C[C@H](C(=O)O)N