Scopine is a tropane alkaloid found in plants such as Mandragora root and certain species of Senecio and Scopolia. It is primarily used as a pharmaceutical intermediate.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 498-45-3
Scopine hydrochloride
pharmaceutical intermediate
Isonipecotic acid
pharmaceutical intermediate
2-Azabicyclo[2.2.1]hept-5-en-3-one
Pharmaceutical intermediate for abacavir synthesis
Mercaptopurine disulfide
Pharmaceutical intermediate for thiopurine derivatives
1-phenethylimidazole
antifungal intermediate
(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol
FIMXSEMBHGTNKT-UPGAHCIJSA-N
CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)O