3,4,5-Trimethoxybenzoyl chloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of phenethylamine derivatives, including mescaline. It features an aromatic ring substituted with three methoxy groups and an acyl chloride group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,4,5-Trimethoxybenzoyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,5-Dimethoxybenzaldehyde
Pharmaceutical intermediate for phenethylamine synthesis
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
(5R)-5-(2,2-Dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one
pharmaceutical intermediate
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
3,4,5-Trimethoxybenzoyl chloride(CAS 4521-61-3)의 국제 HS 코드는 2918.99입니다.
2918.99
2918 99 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
3,4,5-trimethoxybenzoyl chloride
BUHYMJLFRZAFBF-UHFFFAOYSA-N
COC1=CC(=CC(=C1OC)OC)C(=O)Cl
3,4,5-Trimethoxybenzoyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.