3,4,5-Trimethoxybenzoyl chloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of phenethylamine derivatives, including mescaline. It features an aromatic ring substituted with three methoxy groups and an acyl chloride group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4521-61-3
2,5-Dimethoxybenzaldehyde
Pharmaceutical intermediate for phenethylamine synthesis
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
(5R)-5-(2,2-Dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one
pharmaceutical intermediate
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
3,4,5-trimethoxybenzoyl chloride
BUHYMJLFRZAFBF-UHFFFAOYSA-N
COC1=CC(=CC(=C1OC)OC)C(=O)Cl