Tetrapropylammonium hydroxide is a quaternary ammonium compound commonly used as a structure-directing agent in the synthesis of zeolites. It serves as a precursor to important industrial and laboratory catalysts.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4499-86-9
Tetrapropylammonium iodide
Quaternary ammonium salt reagent
Tetrapropylammonium bromide
Phase transfer catalyst and research reagent
4-Methylnonanoic acid
medium-chain fatty acid
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
Ethyl N~2~,N~6~-bis(oxomethylidene)-L-lysinate
diisocyanate monomer for polyurethane synthesis
2,5-Difluorotoluene
chemical intermediate for synthesis
tetrapropylazanium hydroxide
LPSKDVINWQNWFE-UHFFFAOYSA-M
CCC[N+](CCC)(CCC)CCC.[OH-]