Tetrapropylammonium bromide is a quaternary ammonium salt commonly employed as a phase transfer catalyst and a laboratory research reagent. It facilitates the transfer of reactants between immiscible phases, enabling reactions that would otherwise proceed slowly or not at all.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1941-30-6
Tetrapropylammonium hydroxide
Structure-directing agent for zeolite synthesis
Tetrapropylammonium iodide
Quaternary ammonium salt reagent
2-Diethylaminoethanethiol hydrochloride
research compound
EAI045
epidermal growth factor receptor antagonist
Ethyl 1-benzofuran-3-carboxylate
Research reagent
Phenethyl isocyanate
Hapten for research
tetrapropylazanium bromide
BGQMOFGZRJUORO-UHFFFAOYSA-M
CCC[N+](CCC)(CCC)CCC.[Br-]