3-Fluoro-4-nitrotoluene is an industrial chemical used primarily as a chemical intermediate in organic synthesis. It is listed under California Proposition 65 as a substance known to the state to cause cancer or reproductive toxicity based on animal studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 446-34-4
Tetrapropylammonium hydroxide
Structure-directing agent for zeolite synthesis
4-Methylnonanoic acid
medium-chain fatty acid
2-(2-Ethoxyethoxy)ethyl methacrylate
Monomer for polymer synthesis
Ethyl N~2~,N~6~-bis(oxomethylidene)-L-lysinate
diisocyanate monomer for polyurethane synthesis
2-fluoro-4-methyl-1-nitrobenzene
WZMOWQCNPFDWPA-UHFFFAOYSA-N
CC1=CC(=C(C=C1)[N+](=O)[O-])F