2,5-Thiophenedicarboxylic acid is a chemical compound featuring a thiophene ring with two carboxylic acid groups. It serves as a building block for organic synthesis, particularly in the production of various organic compounds and materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4282-31-9
5-acetylthiophene-2-carboxylic acid
Pharmaceutical intermediate for synthesis
4-Butylbenzoic acid
Building block for organic synthesis
9,9-Dimethyl-9H-fluorene
Building block for organic synthesis
4-bromo-3'-chloro-1,1'-biphenyl
Building block for organic synthesis
4-Bromodibenzothiophene
Building block for organic synthesis
2,5-dimethyl furan-2,5-dicarboxylate
Building block for polymer synthesis
Tetrabutylammonium fluoride
Phase-transfer catalyst and organic synthesis reagent
Tripropylene glycol diacrylate
UV-curable coatings and inks monomer
thiophene-2,5-dicarboxylic acid
YCGAZNXXGKTASZ-UHFFFAOYSA-N
C1=C(SC(=C1)C(=O)O)C(=O)O