Tetrabutylammonium fluoride is a fluoride salt and a tetrabutylammonium salt. It is primarily used as a phase-transfer catalyst in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 429-41-4
Tetrabutylammonium fluoride trihydrate
Phase transfer catalyst and fluorination reagent
Tetrabutylammonium borohydride
reducing agent in organic synthesis
(1-Butyl)triethylammonium bromide
phase transfer catalyst
Tripropylene glycol diacrylate
UV-curable coatings and inks monomer
1,2-Dichloro-1-fluoroethane
refrigerant or foam blowing agent
3-Chloropivaloyl chloride
Chemical intermediate
5-(Ethenyloxy)octahydro-1H-4,7-methanoindene
chemical intermediate
tetrabutylazanium fluoride
FPGGTKZVZWFYPV-UHFFFAOYSA-M
CCCC[N+](CCCC)(CCCC)CCCC.[F-]