Dihydrofolic acid (DHF) is a derivative of folic acid (vitamin B9) that serves as a substrate in folate metabolism. It is converted to tetrahydrofolic acid by the enzyme dihydrofolate reductase, a step essential for the synthesis of purines and pyrimidines, the building blocks of DNA and RNA.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4033-27-6
(R)-alpha-Propargylalanine
research compound for peptide synthesis
3,4-DIMETHOXYBENZOPHENONE
research compound
(S)-4-Methyloxazolidin-2-one
research compound
Piperidine-2-carboxylic acid
research compound
10-Formyldihydrofolate
research compound for folate metabolism
(2S)-2-[[4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid
OZRNSSUDZOLUSN-LBPRGKRZSA-N
C1C(=NC2=C(N1)N=C(NC2=O)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O