3,4-Dimethoxybenzophenone is a research compound structurally defined as This compound. It features a benzophenone core with two methoxy substituents on one aromatic ring, contributing to its physicochemical properties such as moderate lipophilicity and low molecular weight.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4038-14-6
(S)-4-Methyloxazolidin-2-one
research compound
Piperidine-2-carboxylic acid
research compound
DICYCLOHEXYL(4-(N,N-DIMETHYLAMINO)PHENYL)PHOSPHINE
organophosphine ligand for catalysis
2,3-dihydro-1H-indene-4-carboxylic Acid
Research compound for organic synthesis
(3,4-dimethoxyphenyl)-phenylmethanone
WCNOATOQNSHEFK-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)OC