2,9-Dibromo-1,10-phenanthroline is a brominated heterocyclic compound used as a ligand in coordination chemistry. Its structure features two bromine atoms at the 2 and 9 positions of the phenanthroline core, providing distinct electronic and steric properties for metal complex formation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,9-DIBROMO-1,10-PHENANTHROLINE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Pyridine-3,5-dicarboxylic acid
research compound for coordination chemistry
2,2'-Bipyridine-4,4'-dicarboxylic acid
research compound for coordination chemistry
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
1,2,3-trichlorobenzene-d3
deuterated analytical reference standard
2-Bromopropane-d7
Deuterated research standard
2-Thiopheneacetyl chloride
chemical intermediate for organic synthesis
N-Methyl-L-alanine
research compound
(PHEN)NIBR2
ligand coordinated nickel complex
2,9-dibromo-1,10-phenanthroline
QNLGXYVSHITTGT-UHFFFAOYSA-N
C1=CC2=C(C3=C1C=CC(=N3)Br)N=C(C=C2)Br
—
2,9-DIBROMO-1,10-PHENANTHROLINE 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.