1,2,3-Trichlorobenzene-d3 is a deuterated derivative of 1,2,3-trichlorobenzene, where three hydrogen atoms are replaced with deuterium. It is primarily used as a deuterated analytical reference standard in research and analytical chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2,3-trichlorobenzene-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Bromopropane-d7
Deuterated research standard
2-Thiopheneacetyl chloride
chemical intermediate for organic synthesis
N-Methyl-L-alanine
research compound
Tert-Butyl 2-bromopropanoate
research reagent
1,2,3-TRICHLOROBENZENE
solvent and heat transfer medium
1,2,3-trichloro-4,5,6-trideuteriobenzene
RELMFMZEBKVZJC-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1[2H])Cl)Cl)Cl)[2H]
1,2,3-trichlorobenzene-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.