This compound is a deuterated derivative of naphthalene, specifically labeled with deuterium atoms at multiple positions including a trideuteriomethyl group. It is primarily used as a reference standard in nuclear magnetic resonance (NMR) spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 38072-94-5
Cyclopentanone-2,2,5,5-d4
Deuterated NMR reference standard
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine
Deuterated NMR reference standard
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
Diethylaminosulfur trifluoride
fluorinating reagent for organofluorine synthesis
Diethyl ((4-(3-fluorophenyl)-2-pyridyl)methyl) phosphonate
research compound
Phenylzinc bromide
organometallic reagent for cross-coupling
1-METHYLNAPHTHALENE
Solvent and chemical intermediate
1,2,3,4,5,6,7-heptadeuterio-8-(trideuteriomethyl)naphthalene
QPUYECUOLPXSFR-UZHHFJDZSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H]