This compound is a deuterated form of piperidine, where all hydrogen atoms are replaced with deuterium. It is primarily used as a reference standard in NMR spectroscopy to calibrate instruments and quantify other compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
8-(Methyl-d3)naphthalene-1,2,3,4,5,6,7-d7
Deuterated NMR reference standard
Cyclopentanone-2,2,5,5-d4
Deuterated NMR reference standard
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
Mal-PEG2-NHS ester
heterobifunctional crosslinking reagent
6-Methoxy-5-methylpyrimidin-4-ol
research compound
DL-Aspartic acid-d3
deuterated amino acid research reagent
L-Glutamine-d5
stable isotope labeled research standard
2,2,3,3,4,4,5,5,6,6-decadeuteropiperidine
deuterated NMR reference standard
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine(CAS 143317-90-2)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine
NQRYJNQNLNOLGT-KTIYLIMOSA-N
[2H]C1(C(C(N(C(C1([2H])[2H])([2H])[2H])[2H])([2H])[2H])([2H])[2H])[2H]
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.