2-(Methoxycarbonyl)benzeneboronic acid is a boronic acid derivative used primarily as a research reagent in organic synthesis. It functions as a coupling partner in Suzuki cross-coupling reactions, enabling the formation of carbon-carbon bonds in complex molecular structures.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 374538-03-1
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
4-tert-Butoxyphenylboronic acid
Suzuki coupling reagent
Pyridine-2-boronic acid, pinacol ester
Suzuki coupling reagent
Nbi 31772
insulin-like growth factor binding protein inhibitor
2-chloro-3-fluoro-6-methylpyridine
research compound
6-Bromo-3-fluoro-2-methylpyridine
Pharmaceutical research compound
Kisspeptin-10 (human)
research peptide for GPR54 ligand studies
(2-methoxycarbonylphenyl)boronic acid
ODAXNYMENLFYMY-UHFFFAOYSA-N
B(C1=CC=CC=C1C(=O)OC)(O)O