4-tert-Butoxyphenylboronic acid is an organoboron compound featuring a boronic acid group attached to a phenyl ring bearing a tert-butoxy substituent. It is primarily used as a reagent in Suzuki coupling reactions for the formation of carbon-carbon bonds in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-tert-Butoxyphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-(Methoxycarbonyl)benzeneboronic Acid
Suzuki coupling reagent
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
Pyridine-2-boronic acid, pinacol ester
Suzuki coupling reagent
8-Bromooctanoic acid
Research reagent for organic synthesis
Methyl (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoate
research compound
2-Methoxyphenothiazine
research compound
3-(Trimethylsilyl)phenylboronic acid
Research reagent for boronic acid coupling
[4-[(2-methylpropan-2-yl)oxy]phenyl]boronic acid
OKHCKPPOCZWHRN-UHFFFAOYSA-N
B(C1=CC=C(C=C1)OC(C)(C)C)(O)O
4-tert-Butoxyphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.