Xylan, hydrogen sulfate is a sulfated polysaccharide compound with an anticoagulant role, primarily used as an active pharmaceutical ingredient (API) in research and pharmaceutical manufacturing. Its structure features a disaccharide backbone with multiple sulfate groups, contributing to its high polarity and water solubility.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Xylan, hydrogen sulfate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-(Aminomethyl)pyridine
active pharmaceutical ingredient
Serratiopeptidase
proteolytic enzyme preparation
Metoprolol
beta-adrenergic antagonist
Tropine benzylate
anticholinergic active pharmaceutical ingredient
Alpha-Lactose monohydrate
nutrient and excipient in food
Lactose
food ingredient and excipient
Beta-D-glucosaminyl-(1->4)-beta-D-glucosamine
chitosan oligosaccharide building block
[(2R,3R,4S,5R)-2-hydroxy-5-[(2S,3R,4S,5R)-5-hydroxy-3,4-disulfooxyoxan-2-yl]oxy-3-sulfooxyoxan-4-yl] hydrogen sulfate
FCCNSUIJIOOXEZ-SJYYZXOBSA-N
C1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2CO[C@H]([C@@H]([C@H]2OS(=O)(=O)O)OS(=O)(=O)O)O)OS(=O)(=O)O)OS(=O)(=O)O)O
Xylan, hydrogen sulfate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.