This compound is a chitosan oligosaccharide building block consisting of two linked glucosamine units. It is primarily used as a structural component for research and synthesis in carbohydrate chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Beta-D-glucosaminyl-(1->4)-beta-D-glucosamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
CHITOSAN HYDROCHLORIDE
Glucosamine derivative for pharmaceutical synthesis
Tetraoctylammonium bromide
Phase transfer catalyst
N-Nitroso Clonidine
Nitrosamine impurity standard
Patulin
mycotoxin analytical reference standard
Glutacondianil hydrochloride
research reagent or chemical intermediate
Alpha-Lactose monohydrate
nutrient and excipient in food
Lactose
food ingredient and excipient
Xylan, hydrogen sulfate
anticoagulant sulfated polysaccharide
(2R,3S,4R,5R,6S)-5-amino-6-[(2R,3S,4R,5R,6R)-5-amino-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-(hydroxymethyl)oxane-3,4-diol
QLTSDROPCWIKKY-PMCTYKHCSA-N
C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)N)O)CO)N)O)O)O
Beta-D-glucosaminyl-(1->4)-beta-D-glucosamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.