Validamycin is an agrochemical compound used as an antibiotic fungicide, primarily for controlling rice sheath blight. It is composed of multiple alcohol and other functional groups, contributing to its high polarity and water solubility.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 37248-47-8
3-Phenoxybenzoic acid
pyrethroid insecticide metabolite
Fenobucarb
Insecticide and pesticide
2-(2-methoxy-ethoxymethyl)-6-trifluoromethyl-nicotinic acid
Agrochemical metabolite
Streptomycin sulfate
antibiotic for bacterial infections
(2R,3R,4S,5S,6R)-2-[(1R,2R,3S,4S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-4-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]cyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
JARYYMUOCXVXNK-CSLFJTBJSA-N
C1[C@@H]([C@H]([C@@H]([C@H]([C@H]1N[C@H]2C=C([C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)CO