2',3'-Isopropylideneguanosine is a nucleoside research compound featuring a protected ribose moiety, commonly used as an intermediate in the synthesis of modified nucleosides. Its structure includes a guanine base and an isopropylidene group that protects the 2' and 3' hydroxyls of the ribose, making it valuable for laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2',3'-Isopropylideneguanosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(+/-)-Methamphetamine-d14
mass spectrometry internal standard
1,1,2,2,3,3,4,4,5,6-decadeuterio-5,6-dimethoxycyclohexane
deuterated research compound
2,4,6-TRIMETHYLPHENOL-D11
deuterated analytical reference standard
2,3,5-TRIMETHYLPHENOL-D11
Deuterated research reagent
2',3'-Isopropylideneguanosine(CAS 362-76-5)의 국제 HS 코드는 2934.99입니다.
2934.99
2934 99 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1H-purin-6-one
XKPDAYWPKILAMO-IOSLPCCCSA-N
CC1(O[C@@H]2[C@H](O[C@H]([C@@H]2O1)N3C=NC4=C3N=C(NC4=O)N)CO)C
2',3'-Isopropylideneguanosine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.