2,4,6-Trimethylphenol-d11 is a deuterated analytical reference standard used primarily in research and analytical chemistry for quantitative analysis and method development. Its structure includes a phenolic ring with three trideuteriomethyl groups and deuterium atoms at specific positions, ensuring high isotopic purity for reliable tracing in mass spectrometry and other analytical techniques.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,4,6-TRIMETHYLPHENOL-D11 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,3,5-TRIMETHYLPHENOL-D11
Deuterated research reagent
Methyl Paraben-d4
deuterated internal standard for analysis
D-Phenylalanine-d5
deuterated amino acid research reagent
1,3-Dioxolan-2-one-d4
deuterated research compound
3,5-dideuterio-2,4,6-tris(trideuteriomethyl)phenol
BPRYUXCVCCNUFE-JXCHDVSKSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H])C([2H])([2H])[2H]
2,4,6-TRIMETHYLPHENOL-D11 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.