4-Bromo-3-nitrobenzotrifluoride is a chemical compound used primarily as an industrial chemical intermediate. It features a bromine atom and a nitro group on an aromatic ring with a trifluoromethyl substituent, making it a versatile building block for further chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Bromo-3-nitrobenzotrifluoride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-BROMOHEPTADECANE
alkyl bromide intermediate
2-Butanone-1,1,1,3,3,4,4,4-d8(9CI)
deuterated solvent or internal standard
2-Methylene-1,3-propanediol
Chemical intermediate for polymer synthesis
Methyl 2-((ethoxycarbonothioyl)thio)propanoate
Synthetic intermediate for organic synthesis
1-bromo-2-nitro-4-(trifluoromethyl)benzene
PESPBNYBZVIGRO-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])Br
—
4-Bromo-3-nitrobenzotrifluoride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.