This compound is a deuterated form of butanone, where all hydrogen atoms are replaced with deuterium. It is primarily used as a deuterated solvent or internal standard in analytical chemistry, particularly in NMR spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 350820-09-6
2-Methylene-1,3-propanediol
Chemical intermediate for polymer synthesis
Methyl 2-((ethoxycarbonothioyl)thio)propanoate
Synthetic intermediate for organic synthesis
4-Fluorotoluene
Chemical intermediate for fluorinated compounds
1-Chloro-4-fluorobenzene
Industrial chemical intermediate
메틸 에틸 케톤
solvent for coatings, adhesives, and cleaning
1,1,1,3,3,4,4,4-octadeuteriobutan-2-one
ZWEHNKRNPOVVGH-AUOAYUKBSA-N
[2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])[2H]