This compound is a salt-like iodonium-based chemical used as a pharmaceutical intermediate. It consists of an aromatic cation paired with a hexafluorophosphate anion.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 344562-80-7
3-(4-fluorophenyl)pentanedioic acid
Pharmaceutical intermediate
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
2-Chloro-5-fluoronitrobenzene
Pharmaceutical intermediate
2-Fluorobenzyl chloride
Pharmaceutical intermediate
Bis(p-tolyl)iodonium hexafluorophosphate
cationic photoinitiator
Diphenyliodonium nitrate
laboratory research reagent
2-(Phenyliodonio)benzoate hydrate
Pharmaceutical intermediate
Di(4-t-butylphenyl)iodonium camphorsulfonate
photoacid generator reagent
(4-methylphenyl)-[4-(2-methylpropyl)phenyl]iodanium hexafluorophosphate
YNDYCGZWQZEBCS-UHFFFAOYSA-N
CC1=CC=C(C=C1)[I+]C2=CC=C(C=C2)CC(C)C.F[P-](F)(F)(F)(F)F