7-methyl-L-tryptophan is a research compound. It is a derivative of the amino acid L-tryptophan, characterized by the presence of a methyl group at the 7-position of the indole ring.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 33468-36-9
4-chloro-6-methoxy-2-methyl-3-propylquinoline
research compound
Di-tert-butyl hydrogen phosphate; potassium salt
Phosphate ester salt reagent
(Z)-N-Ethyl-N-methyl-2-oxo-3-(phenyl((4-(piperidin-1-ylmethyl)phenyl)amino)methylene)indoline-6-carboxamide
research compound
1,2-Dihydroxybenzene-1-13c
Isotope-labeled research compound
(2S)-2-amino-3-(7-methyl-1H-indol-3-yl)propanoic acid
KBOZNJNHBBROHM-JTQLQIEISA-N
CC1=C2C(=CC=C1)C(=CN2)C[C@@H](C(=O)O)N