This compound is a potassium salt of a phosphate ester, commonly utilized as a laboratory reagent in chemical research and synthesis. Its structure features a phosphate group with two tert-butyl substituents and a potassium counterion, conferring specific solubility and reactivity properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Di-tert-butyl hydrogen phosphate; potassium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(Z)-N-Ethyl-N-methyl-2-oxo-3-(phenyl((4-(piperidin-1-ylmethyl)phenyl)amino)methylene)indoline-6-carboxamide
research compound
1,2-Dihydroxybenzene-1-13c
Isotope-labeled research compound
Norleual
research compound
(2S)-2-[(2-Methylpropan-2-yl)oxycarbonylamino](1,2,3-13C3)propanoic acid
Isotopically labeled amino acid derivative
SZCKQRFZBSIRLK-UHFFFAOYSA-N
CC(C)(C)OP(=O)(O)OC(C)(C)C.[K]
—
Di-tert-butyl hydrogen phosphate; potassium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.