Triphenylboroxin is a chemical compound used as a pharmaceutical intermediate in manufacturing and research settings. Its structure features three aromatic rings and a central heterocyclic ring containing boron and oxygen atoms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3262-89-3
(-)-Di-p-toluoyl-L-tartaric acid
chiral resolving agent for pharmaceuticals
17-(Acetyloxy)-6-methylenepregn-4-ene-3,20-dione
pharmaceutical intermediate
Imidazol-4-ylmethanol hydrochloride
pharmaceutical intermediate
Di-tert-butyl Glutamate Hydrochloride
Pharmaceutical intermediate for peptide synthesis
2,4,6-triphenyl-1,3,5,2,4,6-trioxatriborinane
VOXXGUAZBWSUSS-UHFFFAOYSA-N
B1(OB(OB(O1)C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4