Ethyl 4-amino-3,5-dimethylbenzoate is a research compound characterized by an aromatic ring substituted with an amine group and an ester moiety. It is primarily used as a laboratory reagent in chemical and pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3095-47-4
2-Bromo-9-fluorenone
research compound
[1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane;dichlororuthenium;N-methylmethanamine;hydrochloride
asymmetric hydrogenation catalyst
N-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-alanine
Research reagent for peptide synthesis
Dimethyl succinate-d4
deuterated analytical standard
ethyl 4-amino-3,5-dimethylbenzoate
GEMKGDSDLYAIRK-UHFFFAOYSA-N
CCOC(=O)C1=CC(=C(C(=C1)C)N)C