This compound is a research reagent with a complex heterocyclic structure incorporating halogen atoms and a difluoromethoxy group. It is primarily of interest for laboratory-scale studies and chemical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 3039517-14-8
2-Piperidinoethanol
Research compound for synthetic chemistry
D-Arabinoic acid sodium salt
sodium salt of arabinoic acid
3-Aminophenylboronic acid
research compound
8-Methyl-7H-purin-6-ol
research compound
(1R,3R)-1-[2-bromo-6-(difluoromethoxy)phenyl]-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine
Research compound
(1R)-1-[2-bromo-6-(difluoromethoxy)phenyl]-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine
RWHDLZYBIPZZOG-JLOHTSLTSA-N
C1[C@@H](N2C3=C(C=CC(=C3)Cl)N=C2C1N)C4=C(C=CC=C4Br)OC(F)F
—