This compound is a research reagent designed for conjugation studies, featuring a polyethylene glycol-based structure with multiple amide and ether linkages. Its large, flexible molecular architecture makes computational conformer generation impractical, highlighting its specialized nature for advanced bioconjugation applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2959475-51-3
9-(3-bromophenyl-2,4,5,6-d4)-9H-carbazole-1,2,3,4,5,6,7,8-d8
deuterated research compound
3,3'-diselane-1,2-diylbis(2-aminopropanoic acid)
biochemical research reagent
2-Fluoro-4-iodoaniline
research reagent
3,5-Dihydroxybenzyl alcohol
research compound
(2S)-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]-N-[(2R)-1-[2-[2-[2-[2-[3-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethylamino]-1-oxo-3-sulfanylpropan-2-yl]-6-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanamide
HZIKEVLAEMPTBK-HYGNTPKVSA-N
COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)NCCCC[C@@H](C(=O)N[C@@H](CS)C(=O)NCCOCCOCCOCCOCCC(=O)N[C@@H](CS)C(=O)N)NC(=O)CNC(=O)CNC(=O)CN
—