This compound is a diselenide derivative of the amino acid cysteine, characterized by the presence of two amine and two carboxylic acid functional groups. It is primarily used as a research reagent in biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,3'-diselane-1,2-diylbis(2-aminopropanoic acid) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Fluoro-4-iodoaniline
research reagent
3,5-Dihydroxybenzyl alcohol
research compound
Sodium 2-(trifluoromethyl)benzoate
organic synthesis intermediate
Methyl[(naphthalen-1-yl)methyl]nitrosoamine
N-nitrosamine reference standard
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid
JULROCUWKLNBSN-IMJSIDKUSA-N
C([C@@H](C(=O)O)N)[Se][Se]C[C@@H](C(=O)O)N
3,3'-diselane-1,2-diylbis(2-aminopropanoic acid) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.