2,5-Dibromohexanedioyl dichloride is a chemical compound used primarily as a research reagent. Its structure features both bromine and chlorine functional groups, making it valuable for laboratory synthesis and material science studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,5-dibromohexanedioyl dichloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Bromo-5-fluoroanisole
Research reagent
2,3,6-Trichloroquinoxaline
research compound
(R)-A-METHYLLEUCINE
research reagent for peptide synthesis
N-((2R,21R,24S)-1-amino-24-(2-(2-(2-aminoacetamido)acetamido)acetamido)-2,21-bis(mercaptomethyl)-1,4,20,23-tetraoxo-7,10,13,16-tetraoxa-3,19,22-triazaoctacosan-28-yl)-2,5,8,11,14,17,20,23,26,29,32,35,38-tridecaoxahentetracontan-41-amide
Research compound for conjugation studies
2,5-dibromohexanedioyl dichloride
UMIRTQXSYVCPKO-UHFFFAOYSA-N
C(CC(C(=O)Cl)Br)C(C(=O)Cl)Br
—
2,5-dibromohexanedioyl dichloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.