7-Nitroindazole is a small-molecule compound that selectively inhibits neuronal nitric oxide synthase, an enzyme involved in the production of nitric oxide and cellular signaling. It is primarily used as a research reagent in neurochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2942-42-9
8-Bromoadenosine
research compound
Gallic acid-d2
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
7-nitro-1H-indazole
PQCAUHUKTBHUSA-UHFFFAOYSA-N
C1=CC2=C(C(=C1)[N+](=O)[O-])NN=C2