Gallic acid-d2 is a deuterium-labeled reference standard of gallic acid, specifically the This compound isotopologue. It is primarily used as an internal standard or tracer in analytical chemistry and research applications requiring quantification or tracking of gallic acid.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 294660-92-7
3-Hydroxyacetaminophen-d3
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
2-bromo-5-phenylthiophene
research compound
1,4,8,11-Tetraazacyclotetradecane
crown amine for metal coordination
Gallic acid
antioxidant, tanning agent, dyeing intermediate
2,6-dideuterio-3,4,5-trihydroxybenzoic acid
LNTHITQWFMADLM-QDNHWIQGSA-N
[2H]C1=C(C(=C(C(=C1O)O)O)[2H])C(=O)O