Methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate is a chemical compound used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. It is characterized by the presence of an ester group and a trifluoromethyl substituent on a cyclohexane ring, contributing to its role in research and manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 27705-10-8
Methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate
pharmaceutical intermediate
Methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate
Pharmaceutical intermediate
[3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide
Olopatadine intermediate anti-inflammatory
2-(3,4-dimethylphenyl)-5-methyl-1H-pyrazol-3(2H)-one
Pharmaceutical intermediate
Semaglutide impurity 50
Semaglutide process impurity or intermediate
2,2,2-TRIFLUOROETHYL CHLOROFORMATE
Synthetic intermediate in pharmaceutical chemistry
methyl 4-(trifluoromethyl)cyclohexane-1-carboxylate
UKBPRMAOEHOALJ-UHFFFAOYSA-N
COC(=O)C1CCC(CC1)C(F)(F)F
—