[Hydroxy(tosyloxy)iodo]benzene is a hypervalent iodine compound that serves as an oxidizing reagent in organic synthesis. It is characterized by its aromatic rings and a single iodine atom in a hypervalent state, with a molecular weight of approximately 392 g/mol and moderate lipophilicity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 27126-76-7
1-Acetoxy-1,2-benziodoxol-3-one
hypervalent iodine oxidizing reagent
(비스(트라이플루오로아세톡시)아이오도)벤젠
hypervalent iodine oxidizing reagent
3,5-Difluorophenol
Research compound for crystallography studies
2,3-Difluorofumaric acid
research compound
3-[(triphenylmethyl)sulfanyl]propanoic acid
Research reagent for peptide synthesis
FURO[2,3-B]PYRIDINE
research compound
[hydroxy(phenyl)-lambda3-iodanyl] 4-methylbenzenesulfonate
LRIUKPUCKCECPT-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)OI(C2=CC=CC=C2)O