2,3-Difluorofumaric acid is a fluorinated organic compound that exists as the (E)-isomer of 2,3-difluorobut-2-enedioic acid. It is primarily utilized as a research reagent in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,3-Difluorofumaric acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-[(triphenylmethyl)sulfanyl]propanoic acid
Research reagent for peptide synthesis
FURO[2,3-B]PYRIDINE
research compound
Thieno[3,2-c]pyridine
Research compound
Thieno[2,3-b]pyridine
Heterocyclic research compound
(2Z)-2,3-Difluoro-2-butenedioic acid
fluorinated building block for synthesis
(E)-2,3-difluorobut-2-enedioic acid
JUVWKFKXIVLAHQ-OWOJBTEDSA-N
C(=C(/C(=O)O)\F)(\C(=O)O)/F
2,3-Difluorofumaric acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.