2-Fluorotoluene-alpha,alpha,alpha-D3 is a deuterated research compound, specifically a fluorinated toluene derivative where the methyl group is fully deuterated. It is primarily used as a labeled reagent in analytical and synthetic chemistry studies, particularly for tracing reaction pathways or as an internal standard in mass spectrometry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 25319-49-7
1-BROMO-2-(METHYL-D3)BENZENE
Deuterated research reagent
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
1,2-Octanedione, 1-(4-(phenylthio)phenyl)-, 2-(O-benzoyloxime)
research compound
Diethyl cyanomethylphosphonate
phosphonate reagent for synthesis
2-Fluorotoluene
pharmaceutical intermediate
1-fluoro-2-(trideuteriomethyl)benzene
MMZYCBHLNZVROM-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1F