This compound is a Boc-protected amino acid derivative featuring a piperidine ring. It is primarily used as an intermediate in the synthesis of peptides and other pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 252720-31-3
1-[(TERT-BUTOXYCARBONYL)AMINO]CYCLOPROPANECARBOXYLIC ACID
Research compound for peptide synthesis
Methyl 4-((tert-butoxycarbonyl)amino)piperidine-4-carboxylate hydrochloride
Pharmaceutical intermediate for synthesis
1-tert-butoxycarbonylaminocyclopentanecarboxylic acid
Building block for peptide synthesis
Cyclobutanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-
Pharmaceutical intermediate for apalutamide synthesis
(1R,4R)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid
Boc-protected amino acid intermediate
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylic acid
RAENIWWUAIMXSI-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1(CCNCC1)C(=O)O