Guaninyl Valacyclovir is a chemical compound that serves as an impurity of the antiviral prodrug valacyclovir. It is characterized by a complex structure containing multiple heterocyclic rings and functional groups such as amines and an ester.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Guaninyl Valacyclovir 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Bis valacyclovir
Impurity standard for acyclovir
(S)-3-(1-Oxo-5-(piperazin-1-yl)isoindolin-2-yl)piperidine-2,6-dione hydrochloride
active pharmaceutical ingredient
Sevabertinib
reversible HER2/EGFR kinase inhibitor
Zevtera
active pharmaceutical ingredient
Fluorogestone acetate
progestational hormone
Acyclovir Impurity K
reference standard for impurity analysis
2-[[6-oxo-2-[[(6-oxo-1,7-dihydropurin-2-yl)amino]methylamino]-1H-purin-9-yl]methoxy]ethyl (2S)-2-amino-3-methylbutanoate
CWGDDERXPJNSSV-JTQLQIEISA-N
CC(C)[C@@H](C(=O)OCCOCN1C=NC2=C1N=C(NC2=O)NCNC3=NC4=C(C(=O)N3)NC=N4)N
Guaninyl Valacyclovir 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.