Methyl cis-icos-11-enoate is a long-chain fatty acid ester commonly used as a biochemical research reagent. Its structure features an ester group and one carbon-carbon double bond with cis configuration, contributing to its flexible molecular properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2390-09-2
Methyl laurate
flavoring agent and intermediate
Thioflavin T
fluorescent dye for amyloid detection
2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene
research compound for organic synthesis
(S)-ALPHA-METHYLCYSTEINE
research compound
Diethylenetriaminepentaacetic dianhydride
Chemical synthesis intermediate
methyl (E)-icos-11-enoate
RBKMRGOHCLRTLZ-ZHACJKMWSA-N
CCCCCCCC/C=C/CCCCCCCCCC(=O)OC