This compound is a protected amino acid derivative used in peptide synthesis. It features both a benzyloxycarbonyl (Cbz) group and a tert-butoxycarbonyl (Boc) protecting group on the lysine side chain, allowing selective deprotection during solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
IN2-(benzyloxycarbonyl)-N6-(tert-butoxycarbonyl)-L-lysine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Boc-Lys(Z)-OH
protected amino acid for peptide synthesis
(2S)-5-{[(benzyloxy)carbonyl]amino}-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid building block
Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-4-((tert-butoxycarbonyl)amino)butanoate
protected amino acid intermediate
N2,N6-Bis[(phenylmethoxy)carbonyl]-L-lysine
Protected amino acid for peptide synthesis
Carbobenzoxyphenylalanine
protected amino acid for peptide synthesis
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(tert-butoxy)phenyl)propanoic acid
protected amino acid for peptide synthesis
Boc-L-glutamine
protected amino acid for peptide synthesis
Boc-lysine
protected amino acid for peptide synthesis
IN2-(benzyloxycarbonyl)-N6-(tert-butoxycarbonyl)-L-lysine(CAS 2389-60-8)의 국제 HS 코드는 2924.29입니다.
2924.29
2924 29 70
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid
DYSBKEOCHROEGX-HNNXBMFYSA-N
CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1
IN2-(benzyloxycarbonyl)-N6-(tert-butoxycarbonyl)-L-lysine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.