Morpholino U subunit is a chemical compound used as a building block in the synthesis of morpholino oligonucleotides, which are synthetic molecules employed in research to modulate gene expression. The compound features a morpholine ring, a uracil base, and a phosphorus-containing group, reflecting its role in constructing modified oligonucleotide chains.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2388517-98-2
(6-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-tritylmorpholin-2-yl)methyl dimethylphosphoramidochloridate)
Phosphoramidate monomer for oligonucleotide synthesis
H-Lys(Boc)-OMe.HCl
Protected lysine derivative for peptide synthesis
Methyl cis-icos-11-enoate
biochemical research reagent
Thioflavin T
fluorescent dye for amyloid detection
2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene
research compound for organic synthesis
1-[(2R,6S)-6-[[chloro(dimethylamino)phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione
GCLNBTZDWZLIOP-JOLGRYLWSA-N
CN(C)P(=O)(OC[C@@H]1CN(C[C@@H](O1)N2C=CC(=O)NC2=O)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)Cl